ChemNet > CAS > 42182-27-4 2-Amino-4-cyanopyridine
42182-27-4 2-Amino-4-cyanopyridine
| product Name |
2-Amino-4-cyanopyridine |
| CAS No |
42182-27-4 |
| Synonyms |
2-Aminoisonicotinonitrile; 4-Cyano-2-pyridinamine; 2-aminopyridine-4-carbonitrile |
| Molecular Formula |
C6H5N3 |
| Molecular Weight |
119.124 |
| InChI |
InChI=1/C6H5N3/c7-4-5-1-2-9-6(8)3-5/h1-3H,(H2,8,9) |
| Molecular Structure |
|
| Density |
1.23g/cm3 |
| Boiling point |
297.7°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
133.8°C |
| Vapour Pressur |
0.00133mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
